BS for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Bismarck Brown Y is used to stain plant samples, including stems, roots, starch granules, and epidermis.
It is used to stain goblet cells and cartilage.
| Canonical Smiles | C1=CC(=CC(=C1)N=NC2=C(C=C(C=C2)N)N)N=NC3=C(C=C(C=C3)N)N.Cl.Cl |
|---|---|
| IUPAC Name | 4-[[3-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]benzene-1,3-diamine;dihydrochloride |
| InChIKey | MCZVRBLCRZWFJH-UHFFFAOYSA-N |
| INCHI | 1S/C18H18N8.2ClH/c19-11-4-6-17(15(21)8-11)25-23-13-2-1-3-14(10-13)24-26-18-7-5-12(20)9-16(18)22;;/h1-10H,19-22H2;2*1H |
| Isomeric SMILES | C1=CC(=CC(=C1)N=NC2=C(C=C(C=C2)N)N)N=NC3=C(C=C(C=C3)N)N.Cl.Cl |
| WGK Germany | 3 |
| PubChem CID | 82360 |
| Molecular Weight | 419.31 |
| Beilstein | 13,39 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azobenzenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azobenzenes |
| Alternative Parents | Aniline and substituted anilines Azo compounds Propargyl-type 1,3-dipolar organic compounds Primary amines Organopnictogen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Azobenzene - Aniline or substituted anilines - Benzenoid - Monocyclic benzene moiety - Azo compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. |
| External Descriptors | hydrochloride |
| Solubility | Soluble in water. Slightly soluble in ethanol and cellosolve. Insoluble in acetone, carbon tetrachloride and benzene. |
|---|---|
| Sensitivity | Hygroscopic |
| Molecular Weight | 419.300 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 4 |
| Exact Mass | 418.119 Da |
| Monoisotopic Mass | 418.119 Da |
| Topological Polar Surface Area | 154.000 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 454.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Xiao Yang, Hongyang Ma, Yi Chen, Shyam Venkateswaran, Benjamin S. Hsiao. (2024) Functionalization of cellulose acetate nanofibrous membranes for removal of particulate matters and dyes. INTERNATIONAL JOURNAL OF BIOLOGICAL MACROMOLECULES, [PMID:38679253] [10.1016/j.ijbiomac.2024.131852] |
| 2. Yiwen Li, Cuicui Hu, Shikuan Xu, Qi Guo, Pengfei Qi, Rong Li, Yanjun Xing. (2024) ZIF-8 metal-organic network/poly(vinyl alcohol) composite for adsorptive removal of various organic dyes. MATERIALS CHEMISTRY AND PHYSICS, [PMID:] [10.1016/j.matchemphys.2024.129009] |
