Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(CC#N)C[Si](CCCC#N)(Cl)Cl |
|---|---|
| IUPAC Name | 4-[dichloro(3-cyanopropyl)silyl]butanenitrile |
| InChIKey | CVFGRDOVEFUBES-UHFFFAOYSA-N |
| INCHI | 1S/C8H12Cl2N2Si/c9-13(10,7-3-1-5-11)8-4-2-6-12/h1-4,7-8H2 |
| Isomeric SMILES | C(CC#N)C[Si](CCCC#N)(Cl)Cl |
| PubChem CID | 101957 |
| Molecular Weight | 235.18 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Organic cyanides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitriles |
| Alternative Parents | Organochlorosilanes Organic metalloid salts Alkylhalosilanes Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organoheterosilane - Organochlorosilane - Organic metalloid salt - Alkylhalosilane - Nitrile - Carbonitrile - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Organosilicon compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitriles. These are compounds having the structure RC#N; thus C-substituted derivatives of hydrocyanic acid, HC#N. |
| External Descriptors | Not available |
| Boil Point(°C) | 173-7° |
|---|---|
| Molecular Weight | 235.180 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 234.015 Da |
| Monoisotopic Mass | 234.015 Da |
| Topological Polar Surface Area | 47.600 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 211.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |