Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O |
|---|---|
| IUPAC Name | hydroxy-methyl-diphenylsilane |
| InChIKey | MLPRTGXXQKWLDM-UHFFFAOYSA-N |
| INCHI | 1S/C13H14OSi/c1-15(14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14H,1H3 |
| Isomeric SMILES | C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O |
| PubChem CID | 69900 |
| Molecular Weight | 214.33 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | Benzene and substituted derivatives Silanols Organoheterosilanes Organic metalloid salts Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkylarylsilane - Benzenoid - Monocyclic benzene moiety - Organoheterosilane - Organic metalloid salt - Silanol - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
| Molecular Weight | 214.330 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 214.081 Da |
| Monoisotopic Mass | 214.081 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |