Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
2-Iodo-L-phenylalanine is a compound belonging to the class of amino acids. As an amino acid derivative, 2-iodo-L-phenylalanine can serve as a building block for the synthesis of various molecules, such as peptides or proteins. Its unique iodine substitution structure allows for specific interactions or modifications, which can influence the properties or activity of the resulting molecules. In particular, the introduction of iodine atoms can exert diverse effects on the chemical and biological properties of amino acids. For instance, this makes it suitable as a probe or label for radiolabeling or imaging studies, facilitating the detection or tracking of specific proteins or protein modifications. Furthermore, 2-iodo-L-phenylalanine can be used to synthesize crosslinking agents, enabling the covalent linkage of proteins or peptides. This is particularly useful for studying protein-protein interactions or stabilizing protein complexes. Lastly, incorporating 2-iodo-L-phenylalanine into the active site of enzymes or as a substrate can affect their activity or selectivity.
| Canonical Smiles | C1=CC=C(C(=C1)CC(C(=O)O)N)I |
|---|---|
| IUPAC Name | (2S)-2-amino-3-(2-iodophenyl)propanoic acid |
| InChIKey | BKXVGLPBXYBDDM-QMMMGPOBSA-N |
| INCHI | 1S/C9H10INO2/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| Isomeric SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)I |
| Alternate CAS | 167817-55-2 |
| Molecular Weight | 291.09 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Phenylalanine and derivatives |
| Alternative Parents | Phenylpropanoic acids L-alpha-amino acids Amphetamines and derivatives Iodobenzenes Aralkylamines Aryl iodides Amino acids Monocarboxylic acids and derivatives Carboxylic acids Organopnictogen compounds Organoiodides Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylalanine or derivatives - 3-phenylpropanoic-acid - L-alpha-amino acid - Amphetamine or derivatives - Alpha-amino acid - Aralkylamine - Iodobenzene - Halobenzene - Benzenoid - Monocyclic benzene moiety - Aryl iodide - Aryl halide - Amino acid - Monocarboxylic acid or derivatives - Carboxylic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Organoiodide - Organohalogen compound - Primary aliphatic amine - Carbonyl group - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylalanine and derivatives. These are compounds containing phenylalanine or a derivative thereof resulting from reaction of phenylalanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | Not available |
| Sensitivity | light sensitive |
|---|---|
| Melt Point(°C) | >198° C (dec.) |
| Molecular Weight | 291.090 g/mol |
| XLogP3 | -0.900 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 290.976 Da |
| Monoisotopic Mass | 290.976 Da |
| Topological Polar Surface Area | 63.300 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 186.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |