Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Desiccated Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1CN(C(=O)C(=C1)N2CCOCC2)C3=CC=C(C=C3)I |
|---|---|
| IUPAC Name | 1-(4-iodophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
| InChIKey | UWWMPOYYIGCWEH-UHFFFAOYSA-N |
| INCHI | 1S/C15H17IN2O2/c16-12-3-5-13(6-4-12)18-7-1-2-14(15(18)19)17-8-10-20-11-9-17/h2-6H,1,7-11H2 |
| Isomeric SMILES | C1CN(C(=O)C(=C1)N2CCOCC2)C3=CC=C(C=C3)I |
| Molecular Weight | 384.22 |
| Reaxy-Rn | 10564647 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10564647&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Alpha amino acids and derivatives |
| Alternative Parents | Iodobenzenes Aryl iodides Hydropyridines Morpholines Tertiary carboxylic acid amides Trialkylamines Lactams Oxacyclic compounds Azacyclic compounds Dialkyl ethers Enamines Carbonyl compounds Hydrocarbon derivatives Organopnictogen compounds Organoiodides Organic oxides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alpha-amino acid or derivatives - Halobenzene - Iodobenzene - Aryl halide - Aryl iodide - Monocyclic benzene moiety - Hydropyridine - Benzenoid - Oxazinane - Morpholine - Tertiary carboxylic acid amide - Carboxamide group - Tertiary aliphatic amine - Tertiary amine - Lactam - Dialkyl ether - Enamine - Ether - Oxacycle - Azacycle - Organoheterocyclic compound - Organic oxygen compound - Amine - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organopnictogen compound - Organic oxide - Organooxygen compound - Organonitrogen compound - Organohalogen compound - Organoiodide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. |
| External Descriptors | Not available |
| Sensitivity | Light sensitive |
|---|---|
| Flash Point(°C) | 246.203°C |
| Boil Point(°C) | 483.485°C |
| Molecular Weight | 384.210 g/mol |
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 384.033 Da |
| Monoisotopic Mass | 384.033 Da |
| Topological Polar Surface Area | 32.800 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 385.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |