≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488186293 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488186293 |
| Canonical Smiles | C1=CC=C(C=C1)C[N+]2=CC=CC3=CC=CC=C32.[Cl-] |
| IUPAC Name | 1-benzylquinolin-1-ium;chloride |
| InChIKey | GFEJZIULYONCQB-UHFFFAOYSA-M |
| INCHI | 1S/C16H14N.ClH/c1-2-7-14(8-3-1)13-17-12-6-10-15-9-4-5-11-16(15)17;/h1-12H,13H2;1H/q+1;/p-1 |
| Isomeric SMILES | C1=CC=C(C=C1)C[N+]2=CC=CC3=CC=CC=C32.[Cl-] |
| Molecular Weight | 255.75 |
| Reaxy-Rn | 3920092 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3920092&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | 1-benzylquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-benzylquinolines |
| Alternative Parents | Pyridinium derivatives Benzene and substituted derivatives Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1-benzylquinoline - Benzenoid - Pyridinium - Pyridine - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1-benzylquinolines. These are organic aromatic compounds containing a quinoline that is substituted at the 1-position by a benzyl group. |
| External Descriptors | Not available |
| Molecular Weight | 255.740 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 255.081 Da |
| Monoisotopic Mass | 255.081 Da |
| Topological Polar Surface Area | 3.900 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Hugang Zhang, Xinmiao Li, Yile Wang, Kai Deng, Hongjie Yu, You Xu, Hongjing Wang, Ziqiang Wang, Liang Wang. (2023) Porous PdZn bimetallene for oxygen reduction electrolysis. APPLIED CATALYSIS B-ENVIRONMENTAL, [PMID:] [10.1016/j.apcatb.2023.123006] |
| 2. Jiali Sheng, Jiahui Chen, Jiahui Kang, Yan Yu, Ning Yan, Xian-Zhu Fu, Rong Sun, Ching-Ping Wong. (2019) Octahedral Cu2O@Co(OH)2 Nanocages with Hierarchical Flake-Like Walls and Yolk-Shell Structures for Enhanced Electrocatalytic Activity. ChemCatChem, 11 (10): (2520-2525). [PMID:] [10.1002/cctc.201900036] |
I1909052