Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
2-Keto-D-Glucose is a useful synthetic intermediate.
| pKa | pKa: 8.62 (Predicted) |
|---|
| Canonical Smiles | C(C(C(C(C(=O)C=O)O)O)O)O |
|---|---|
| IUPAC Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanal |
| InChIKey | DCNMIDLYWOTSGK-HSUXUTPPSA-N |
| INCHI | 1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,4-6,8,10-12H,2H2/t4-,5-,6-/m1/s1 |
| Isomeric SMILES | C([C@H]([C@H]([C@@H](C(=O)C=O)O)O)O)O |
| WGK Germany | 3 |
| Molecular Weight | 178.14 |
| Beilstein | 1725425 |
| Reaxy-Rn | 3604769 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3604769&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Monosaccharides |
| Direct Parent | Hexoses |
| Alternative Parents | Medium-chain aldehydes Beta-hydroxy ketones Beta-hydroxy aldehydes Acyloins Alpha-hydroxy ketones Alpha ketoaldehydes Secondary alcohols Polyols Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hexose monosaccharide - Medium-chain aldehyde - Acyloin - Beta-hydroxy aldehyde - Beta-hydroxy ketone - Alpha-ketoaldehyde - Alpha-hydroxy ketone - Secondary alcohol - Ketone - Polyol - Organic oxide - Primary alcohol - Hydrocarbon derivative - Aldehyde - Alcohol - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as hexoses. These are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. |
| External Descriptors | ketoaldohexose |
| Solubility | Soluble in methanol, and water. |
|---|---|
| Refractive Index | n20D1.55 (Predicted) |
| Boil Point(°C) | 480.99° C at 760 mmHg (Predicted) |
| Melt Point(°C) | 124.69° C (Predicted) |
| Molecular Weight | 178.140 g/mol |
| XLogP3 | -2.900 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 178.048 Da |
| Monoisotopic Mass | 178.048 Da |
| Topological Polar Surface Area | 115.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 167.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |