Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | COC1=C(C=C(C(=C1)C(=O)O)N2CCCC2=O)OC |
|---|---|
| IUPAC Name | 4,5-dimethoxy-2-(2-oxopyrrolidin-1-yl)benzoic acid |
| InChIKey | IQEAQDYYCKEESH-UHFFFAOYSA-N |
| INCHI | 1S/C13H15NO5/c1-18-10-6-8(13(16)17)9(7-11(10)19-2)14-5-3-4-12(14)15/h6-7H,3-5H2,1-2H3,(H,16,17) |
| Isomeric SMILES | COC1=C(C=C(C(=C1)C(=O)O)N2CCCC2=O)OC |
| PubChem CID | 16774664 |
| Molecular Weight | 265.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Acylaminobenzoic acid and derivatives |
| Alternative Parents | M-methoxybenzoic acids and derivatives P-methoxybenzoic acids and derivatives Phenylpyrrolidines Dimethoxybenzenes Benzoic acids Methoxyanilines Phenoxy compounds Benzoyl derivatives Anisoles Alkyl aryl ethers Pyrrolidine-2-ones Pyrroles Tertiary carboxylic acid amides Vinylogous amides Lactams Azacyclic compounds Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Carbonyl compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Acylaminobenzoic acid or derivatives - M-methoxybenzoic acid or derivatives - P-methoxybenzoic acid or derivatives - 1-phenylpyrrolidine - O-dimethoxybenzene - Dimethoxybenzene - Benzoic acid - Methoxyaniline - Phenoxy compound - Anisole - Benzoyl - Methoxybenzene - Phenol ether - Alkyl aryl ether - Pyrrolidone - 2-pyrrolidone - Vinylogous amide - Pyrrole - Pyrrolidine - Tertiary carboxylic acid amide - Carboxamide group - Lactam - Organoheterocyclic compound - Carboxylic acid derivative - Carboxylic acid - Ether - Azacycle - Monocarboxylic acid or derivatives - Organic oxygen compound - Organopnictogen compound - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Carbonyl group - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as acylaminobenzoic acid and derivatives. These are derivatives of amino benzoic acid derivatives where the amine group is N-acylated. |
| External Descriptors | Not available |
| Molecular Weight | 265.260 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 265.095 Da |
| Monoisotopic Mass | 265.095 Da |
| Topological Polar Surface Area | 76.100 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 359.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |