| Canonical Smiles | CC(C)C(C(=O)NC(CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
|---|---|
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | DALMAZHDNFCDRP-VMPREFPWSA-N |
| INCHI | 1S/C33H39N5O6/c1-20(2)29(38-33(43)44-19-27-25-10-5-3-8-23(25)24-9-4-6-11-26(24)27)31(41)37-28(12-7-17-35-32(34)42)30(40)36-22-15-13-21(18-39)14-16-22/h3-6,8-11,13-16,20,27-29,39H,7,12,17-19H2,1-2H3,(H,36,40)(H,37,41)(H,38,43)(H3,34,35,42)/t28-,29-/m0/s1 |
| Isomeric SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
| Molecular Weight | 601.7 |
| Reaxy-Rn | 30211956 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=30211956&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Peptides |
| Direct Parent | Dipeptides |
| Alternative Parents | Valine and derivatives Fluorenes N-acyl-alpha amino acids and derivatives Alpha amino acid amides Anilides Benzyl alcohols N-arylamides N-acyl amines Carbamate esters Ureas Secondary carboxylic acid amides Hydrocarbon derivatives Organopnictogen compounds Carbonyl compounds Primary alcohols Aromatic alcohols Organic oxides |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Alpha-dipeptide - N-acyl-alpha amino acid or derivatives - Valine or derivatives - Fluorene - Alpha-amino acid amide - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Anilide - Benzyl alcohol - N-arylamide - Monocyclic benzene moiety - N-acyl-amine - Fatty acyl - Fatty amide - Benzenoid - Carbamic acid ester - Urea - Carboxamide group - Secondary carboxylic acid amide - Alcohol - Organonitrogen compound - Organooxygen compound - Primary alcohol - Aromatic alcohol - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. |
| External Descriptors | Not available |
| Sensitivity | Light Sensitive,Moisture Sensitive,Heat Sensitive |
|---|---|
| Melt Point(°C) | 204 °C(dec.) |
| Molecular Weight | 601.700 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 14 |
| Exact Mass | 601.29 Da |
| Monoisotopic Mass | 601.29 Da |
| Topological Polar Surface Area | 172.000 Ų |
| Heavy Atom Count | 44 |
| Formal Charge | 0 |
| Complexity | 948.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
