Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528768974 |
|---|---|
| Canonical Smiles | C(C(C(F)(F)F)(Cl)Cl)(C(F)(F)F)(F)Cl |
| IUPAC Name | 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluorobutane |
| InChIKey | ZPGMWBFCBUKITA-UHFFFAOYSA-N |
| INCHI | 1S/C4Cl3F7/c5-1(6,3(9,10)11)2(7,8)4(12,13)14 |
| Isomeric SMILES | C(C(C(F)(F)F)(Cl)Cl)(C(F)(F)F)(F)Cl |
| Molecular Weight | 287.39 |
| Reaxy-Rn | 1777522 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1777522&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Alkyl halides |
| Subclass | Alkyl chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chlorofluorocarbons |
| Alternative Parents | Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Chlorofluorocarbon - Hydrocarbon derivative - Organofluoride - Organochloride - Alkyl fluoride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as chlorofluorocarbons. These are alkyhalide compounds that are composed only of chlorine, fluorine, and carbon atoms. |
| External Descriptors | Not available |
| Refractive Index | 1.353 |
|---|---|
| Boil Point(°C) | 98℃ |
| Melt Point(°C) | 4℃ |
| Molecular Weight | 287.390 g/mol |
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 285.895 Da |
| Monoisotopic Mass | 285.895 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 218.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |