Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(C(C(=O)O)NC(=O)N)C(=O)O |
|---|---|
| IUPAC Name | (2S)-2-(carbamoylamino)butanedioic acid |
| InChIKey | HLKXYZVTANABHZ-REOHCLBHSA-N |
| INCHI | 1S/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/t2-/m0/s1 |
| Isomeric SMILES | C([C@@H](C(=O)O)NC(=O)N)C(=O)O |
| Alternate CAS | 13184-27-5 |
| PubChem CID | 93072 |
| MeSH Entry Terms | carbamyl-DL-aspartate;carbamylaspartic acid;N-carbamoyl-D-aspartic acid;N-carbamoyl-L-aspartic acid;N-carbamoylaspartic acid;N-carbamoylaspartic acid, D-;N-carbamoylaspartic acid, DL-;ureidosuccinic acid;ureidosuccinic acid, (D)-isomer;ureidosuccinic acid |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Aspartic acid and derivatives |
| Alternative Parents | Fatty acids and conjugates Dicarboxylic acids and derivatives Isoureas Carboxylic acids Carboximidamides Organopnictogen compounds Organic oxides Imines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Aspartic acid or derivatives - Dicarboxylic acid or derivatives - Fatty acid - Isourea - Carboximidamide - Carboxylic acid - Carboximidic acid derivative - Organic oxide - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organooxygen compound - Organonitrogen compound - Imine - Organopnictogen compound - Organic oxygen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as aspartic acid and derivatives. These are compounds containing an aspartic acid or a derivative thereof resulting from reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | L-aspartic acid derivative - N-carbamoyl-L-amino acid - N-carbamoylaspartic acid |
| Molecular Weight | 176.130 g/mol |
|---|---|
| XLogP3 | -1.900 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 176.043 Da |
| Monoisotopic Mass | 176.043 Da |
| Topological Polar Surface Area | 130.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 214.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |