Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C)(C)C1=CC=C(C=C1)Cl |
|---|---|
| IUPAC Name | (4-chlorophenyl)-trimethylsilane |
| InChIKey | LCQUSGXMZKOTPG-UHFFFAOYSA-N |
| INCHI | 1S/C9H13ClSi/c1-11(2,3)9-6-4-8(10)5-7-9/h4-7H,1-3H3 |
| Isomeric SMILES | C[Si](C)(C)C1=CC=C(C=C1)Cl |
| PubChem CID | 66351 |
| Molecular Weight | 184.74 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chlorobenzenes |
| Alternative Parents | Alkylarylsilanes Aryl chlorides Organic metalloid salts Organochlorides Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkylarylsilane - Chlorobenzene - Aryl halide - Aryl chloride - Organic metalloid salt - Hydrocarbon derivative - Organic salt - Organosilicon compound - Alkylsilane - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as chlorobenzenes. These are compounds containing one or more chlorine atoms attached to a benzene moiety. |
| External Descriptors | Not available |
| Boil Point(°C) | 206° |
|---|---|
| Molecular Weight | 184.740 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 184.048 Da |
| Monoisotopic Mass | 184.048 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 120.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |