Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(C)(C)OC(=O)N1CCC(CC1)S(=O)(=O)N |
|---|---|
| IUPAC Name | tert-butyl 4-sulfamoylpiperidine-1-carboxylate |
| InChIKey | UWKMBLJEIZMDIM-UHFFFAOYSA-N |
| INCHI | 1S/C10H20N2O4S/c1-10(2,3)16-9(13)12-6-4-8(5-7-12)17(11,14)15/h8H,4-7H2,1-3H3,(H2,11,14,15) |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC(CC1)S(=O)(=O)N |
| PubChem CID | 66589106 |
| Molecular Weight | 264.34 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinesulfonamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinesulfonamides |
| Alternative Parents | Piperidinecarboxylic acids Organosulfonamides Organic sulfonamides Carbamate esters Aminosulfonyl compounds Tertiary amines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine sulfonamide - Piperidinecarboxylic acid - Organic sulfonic acid amide - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Carbamic acid ester - Aminosulfonyl compound - Tertiary amine - Azacycle - Hydrocarbon derivative - Amine - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organosulfur compound - Carbonyl group - Organonitrogen compound - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinesulfonamides. These are organic compounds containing a sulfonamide group linked to a piperidine ring. |
| External Descriptors | Not available |
| Molecular Weight | 264.340 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 264.114 Da |
| Monoisotopic Mass | 264.114 Da |
| Topological Polar Surface Area | 98.100 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 372.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |