Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=CC=C2C(=C1)C(=CN2)CCNC(=S)NC3=C(C=C(C=C3)Cl)Cl |
|---|---|
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea |
| InChIKey | VADXKBJLAGFANN-UHFFFAOYSA-N |
| INCHI | 1S/C17H15Cl2N3S/c18-12-5-6-16(14(19)9-12)22-17(23)20-8-7-11-10-21-15-4-2-1-3-13(11)15/h1-6,9-10,21H,7-8H2,(H2,20,22,23) |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=S)NC3=C(C=C(C=C3)Cl)Cl |
| PubChem CID | 1347863 |
| Molecular Weight | 364.3 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | N-phenylthioureas |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-phenylthioureas |
| Alternative Parents | 3-alkylindoles Dichlorobenzenes Substituted pyrroles Aryl chlorides Heteroaromatic compounds Thioureas Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | N-phenylthiourea - 3-alkylindole - Indole - Indole or derivatives - 1,3-dichlorobenzene - Chlorobenzene - Halobenzene - Substituted pyrrole - Aryl chloride - Aryl halide - Pyrrole - Heteroaromatic compound - Thiourea - Azacycle - Organoheterocyclic compound - Organosulfur compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-phenylthioureas. These are compounds containing a N-phenylthiourea moiety, which is structurally characterized by a phenyl group linked to one nitrogen atom of a thiourea group. |
| External Descriptors | Not available |
| Molecular Weight | 364.300 g/mol |
|---|---|
| XLogP3 | 4.900 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 4 |
| Exact Mass | 363.036 Da |
| Monoisotopic Mass | 363.036 Da |
| Topological Polar Surface Area | 71.900 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 409.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |