Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=CC(=CC=C1C(=O)O)N=C(N)N=C(N)N.Cl |
|---|---|
| IUPAC Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid;hydrochloride |
| InChIKey | WOUYATLTHNXCBZ-UHFFFAOYSA-N |
| INCHI | 1S/C9H11N5O2.ClH/c10-8(11)14-9(12)13-6-3-1-5(2-4-6)7(15)16;/h1-4H,(H,15,16)(H6,10,11,12,13,14);1H |
| Molecular Weight | 257.680 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Aminobenzoic acids and derivatives - Guanidinobenzoic acids and derivatives |
| Direct Parent | Guanidinobenzoic acids |
| Alternative Parents | 1-arylbiguanides Benzoic acids Benzoyl derivatives Monocarboxylic acids and derivatives Carboxylic acids Carboximidamides Organopnictogen compounds Organooxygen compounds Organic oxides Imines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Guanidinobenzoic acid - 1-arylbiguanide - Arylbiguanide - Benzoic acid - Benzoyl - Biguanide - Guanidine - Carboximidamide - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Hydrochloride - Organooxygen compound - Organonitrogen compound - Imine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as guanidinobenzoic acids. These are aromatic compounds containing a guanidine group linked to the benzene ring of a benzoic acid. |
| External Descriptors | Not available |
| Molecular Weight | 257.680 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 257.068 Da |
| Monoisotopic Mass | 257.068 Da |
| Topological Polar Surface Area | 140.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 314.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |