Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
GRADE & PURITY ≥95%
Storage
Room temperature
Shipped In
Normal
| Canonical Smiles | CCC1=CC=C(C=C1)C2=CN=NC(=N2)NN |
|---|---|
| IUPAC Name | [5-(4-ethylphenyl)-1,2,4-triazin-3-yl]hydrazine |
| InChIKey | RTORDBDRTYVRHS-UHFFFAOYSA-N |
| INCHI | 1S/C11H13N5/c1-2-8-3-5-9(6-4-8)10-7-13-16-11(14-10)15-12/h3-7H,2,12H2,1H3,(H,14,15,16) |
| Isomeric SMILES | CCC1=CC=C(C=C1)C2=CN=NC(=N2)NN |
| PubChem CID | 28064042 |
| Molecular Weight | 215.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,2,4-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,2,4-triazines |
| Alternative Parents | Benzene and substituted derivatives Heteroaromatic compounds Azacyclic compounds Hydrocarbon derivatives Hydrazines and derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 1,2,4-triazine - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Hydrazine derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,2,4-triazines. These are compounds containing a triazine ring, which is a heterocyclic ring, similar to the six-member benzene ring but with three carbons replaced by nitrogen atoms, at ring positions 1, 2, and 4. |
| External Descriptors | Not available |
| Molecular Weight | 215.250 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 215.117 Da |
| Monoisotopic Mass | 215.117 Da |
| Topological Polar Surface Area | 76.700 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 203.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |