Determine the necessary mass, volume, or concentration for preparing a solution.
≥93%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504767880 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767880 |
| Canonical Smiles | COC1=CC=C(C=C1)[Si](OC)(OC)OC |
| IUPAC Name | trimethoxy-(4-methoxyphenyl)silane |
| InChIKey | ZESWBFKRPIRQCD-UHFFFAOYSA-N |
| INCHI | 1S/C10H16O4Si/c1-11-9-5-7-10(8-6-9)15(12-2,13-3)14-4/h5-8H,1-4H3 |
| Isomeric SMILES | COC1=CC=C(C=C1)[Si](OC)(OC)OC |
| PubChem CID | 15532216 |
| Molecular Weight | 228.32 |
| Reaxy-Rn | 2844597 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Trialkoxysilanes Phenoxy compounds Methoxybenzenes Alkyl aryl ethers Silyl ethers Organoheterosilanes Organic metalloid salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Trialkoxysilane - Alkyl aryl ether - Monocyclic benzene moiety - Alkoxysilane - Silyl ether - Ether - Organoheterosilane - Organic metalloid salt - Organic oxygen compound - Organosilicon compound - Organooxygen compound - Organic metalloid moeity - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
| Sensitivity | Moisture Sensitive |
|---|---|
| Refractive Index | 1.49 |
| Flash Point(°C) | 94°C(lit.) |
| Boil Point(°C) | 144°C/15mmHg(lit.) |
| Molecular Weight | 228.320 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 228.082 Da |
| Monoisotopic Mass | 228.082 Da |
| Topological Polar Surface Area | 36.900 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 168.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |