Determine the necessary mass, volume, or concentration for preparing a solution.
≥97%(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | COC1=CC=CC=C1[Bi](C2=CC=CC=C2OC)C3=CC=CC=C3OC |
|---|---|
| IUPAC Name | tris(2-methoxyphenyl)bismuthane |
| InChIKey | VFWRGMGLLNCHIA-UHFFFAOYSA-N |
| INCHI | 1S/3C7H7O.Bi/c3*1-8-7-5-3-2-4-6-7;/h3*2-5H,1H3; |
| Isomeric SMILES | COC1=CC=CC=C1[Bi](C2=CC=CC=C2OC)C3=CC=CC=C3OC |
| PubChem CID | 2734045 |
| Molecular Weight | 530.38 |
| Beilstein | 16(2)597 |
| Reaxy-Rn | 3913687 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Alkyl aryl ethers Metal aryls Organopnictogen compounds Organo-post-transition metal compounds Organic salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Methoxybenzene - Anisole - Alkyl aryl ether - Metal aryl - Monocyclic benzene moiety - Ether - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Organooxygen compound - Organometallic compound - Organic post-transition metal moeity - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
| Melt Point(°C) | 163 °C |
|---|---|
| Molecular Weight | 530.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 530.129 Da |
| Monoisotopic Mass | 530.129 Da |
| Topological Polar Surface Area | 27.700 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 334.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |