Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Irgarol is a photosystem-II (PSII) herbicide that inhibits photosynthetic electron transport in chloroplasts.
| Pubchem Sid | 488186664 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488186664 |
| Canonical Smiles | CC(C)(C)NC1=NC(=NC(=N1)NC2CC2)SC |
| IUPAC Name | 2-N-tert-butyl-4-N-cyclopropyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
| InChIKey | HDHLIWCXDDZUFH-UHFFFAOYSA-N |
| INCHI | 1S/C11H19N5S/c1-11(2,3)16-9-13-8(12-7-5-6-7)14-10(15-9)17-4/h7H,5-6H2,1-4H3,(H2,12,13,14,15,16) |
| Isomeric SMILES | CC(C)(C)NC1=NC(=NC(=N1)NC2CC2)SC |
| RTECS | XY5850675 |
| Molecular Weight | 253.37 |
| Reaxy-Rn | 792218 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=792218&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,3,5-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylthio-s-triazines |
| Alternative Parents | Alkyl-2-thio-S-triazines Secondary alkylarylamines Aminotriazines Alkylarylthioethers Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylthio-s-triazine - Alkyl-2-thio-s-triazine - Aryl thioether - Amino-1,3,5-triazine - Aminotriazine - Secondary aliphatic/aromatic amine - Alkylarylthioether - Heteroaromatic compound - Azacycle - Sulfenyl compound - Thioether - Secondary amine - Amine - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Organopnictogen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methylthio-s-triazines. These are aromatic compounds containing a 1,3,5-triazine ring that is substituted at the 2-position with a methylthio group. |
| External Descriptors | aryl sulfide - diamino-1,3,5-triazine - cyclopropanes |
| Solubility | Insoluble in water |
|---|---|
| Melt Point(°C) | 128 °C |
| Molecular Weight | 253.370 g/mol |
| XLogP3 | 3.900 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 253.136 Da |
| Monoisotopic Mass | 253.136 Da |
| Topological Polar Surface Area | 88.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 251.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yang Guo, Erzhuo Zhao, Jun Wang, Xiaoyuan Zhang, Haiou Huang, Gang Yu, Yujue Wang. (2019) Comparison of emerging contaminant abatement by conventional ozonation, catalytic ozonation, O3/H2O2 and electro-peroxone processes. JOURNAL OF HAZARDOUS MATERIALS, [PMID:31836369] [10.1016/j.jhazmat.2019.121829] |
| 2. Lingling Zhang, Zhaoxi Zhang, Xi He, Lei Zheng, Shikun Cheng, Zifu Li. (2018) Diminished inhibitory impact of ZnO nanoparticles on anaerobic fermentation by the presence of TiO2 nanoparticles: Phenomenon and mechanism. SCIENCE OF THE TOTAL ENVIRONMENT, [PMID:30081368] [10.1016/j.scitotenv.2018.07.468] |