Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(C)N1CC2CN(CC(C1)C2=O)C(C)C |
|---|---|
| IUPAC Name | 3,7-di(propan-2-yl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
| InChIKey | YGTKXITWJVCHQV-UHFFFAOYSA-N |
| INCHI | 1S/C13H24N2O/c1-9(2)14-5-11-7-15(10(3)4)8-12(6-14)13(11)16/h9-12H,5-8H2,1-4H3 |
| Isomeric SMILES | CC(C)N1CC2CN(CC(C1)C2=O)C(C)C |
| PubChem CID | 10704378 |
| Molecular Weight | 224.34 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinones |
| Alternative Parents | Trialkylamines Ketones Azacyclic compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Piperidinone - Tertiary aliphatic amine - Tertiary amine - Ketone - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinones. These are compounds containing a piperidine ring which bears a ketone. |
| External Descriptors | Not available |
| Molecular Weight | 224.340 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 224.189 Da |
| Monoisotopic Mass | 224.189 Da |
| Topological Polar Surface Area | 23.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 237.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |