Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 508808789 |
|---|---|
| Canonical Smiles | C[Si](C)(C)C#CC1=CN=CC=C1 |
| IUPAC Name | trimethyl(2-pyridin-3-ylethynyl)silane |
| InChIKey | MTMBLPOPETZZRX-UHFFFAOYSA-N |
| INCHI | 1S/C10H13NSi/c1-12(2,3)8-6-10-5-4-7-11-9-10/h4-5,7,9H,1-3H3 |
| Isomeric SMILES | C[Si](C)(C)C#CC1=CN=CC=C1 |
| WGK Germany | 3 |
| PubChem CID | 4100857 |
| Molecular Weight | 175.3 |
| Reaxy-Rn | 4379647 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Heteroaromatic compounds Trialkylsilanes Organic metalloid salts Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine - Heteroaromatic compound - Trialkylsilane - Azacycle - Organic metalloid salt - Organic nitrogen compound - Hydrocarbon derivative - Organosilicon compound - Alkylsilane - Organonitrogen compound - Organic metalloid moeity - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
| Sensitivity | Heat,Air & Moisture sensitive |
|---|---|
| Refractive Index | 1.53 |
| Flash Point(°F) | 201.2 °F |
| Flash Point(°C) | 94 °C |
| Boil Point(°C) | 229°C |
| Molecular Weight | 175.300 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 175.082 Da |
| Monoisotopic Mass | 175.082 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 203.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |