Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
GRADE & PURITY ≥90%
Storage
Room temperature
| Canonical Smiles | CC1=C(C=C(C=C1)NCC2=C(C=CC(=C2)Br)O)C |
|---|---|
| IUPAC Name | 4-bromo-2-[(3,4-dimethylanilino)methyl]phenol |
| InChIKey | YTRXTWUSKNADKA-UHFFFAOYSA-N |
| INCHI | 1S/C15H16BrNO/c1-10-3-5-14(7-11(10)2)17-9-12-8-13(16)4-6-15(12)18/h3-8,17-18H,9H2,1-2H3 |
| Isomeric SMILES | CC1=C(C=C(C=C1)NCC2=C(C=CC(=C2)Br)O)C |
| PubChem CID | 822026 |
| Molecular Weight | 306.21 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylmethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylbenzamines |
| Alternative Parents | o-Xylenes Phenylalkylamines P-bromophenols Benzylamines Aniline and substituted anilines Secondary alkylarylamines Bromobenzenes 1-hydroxy-2-unsubstituted benzenoids Aryl bromides Organopnictogen compounds Organooxygen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylbenzamine - Benzylamine - 4-halophenol - 4-bromophenol - Aniline or substituted anilines - O-xylene - Xylene - Phenylalkylamine - Bromobenzene - Halobenzene - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Secondary aliphatic/aromatic amine - Aralkylamine - Aryl bromide - Aryl halide - Secondary amine - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Organic nitrogen compound - Amine - Organopnictogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylbenzamines. These are aromatic compounds consisting of a benzyl group that is N-linked to a benzamine. |
| External Descriptors | Not available |
| Molecular Weight | 306.200 g/mol |
|---|---|
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 305.042 Da |
| Monoisotopic Mass | 305.042 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 261.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |