Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488202773 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488202773 |
| Canonical Smiles | C1=CC=C(C=C1)C(=O)N2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br |
| IUPAC Name | (3,6-dibromocarbazol-9-yl)-phenylmethanone |
| InChIKey | SQONRPMZFYXHTA-UHFFFAOYSA-N |
| INCHI | 1S/C19H11Br2NO/c20-13-6-8-17-15(10-13)16-11-14(21)7-9-18(16)22(17)19(23)12-4-2-1-3-5-12/h1-11H |
| Molecular Weight | 429.11 |
| Reaxy-Rn | 272494 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=272494&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Indoles and derivatives |
| Subclass | Benzoylindoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoylindoles |
| Alternative Parents | Polybrominated biphenyls Carbazoles Indolecarboxylic acids and derivatives Benzoic acids and derivatives Indoles Benzoyl derivatives Substituted pyrroles Aryl bromides Heteroaromatic compounds Azacyclic compounds Organobromides Organic oxides Organopnictogen compounds Hydrocarbon derivatives Organonitrogen compounds Organooxygen compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzoylindole - Polybrominated biphenyl - Carbazole - Indolecarboxylic acid derivative - Benzoic acid or derivatives - Indole - Benzoyl - Aryl bromide - Aryl halide - Monocyclic benzene moiety - Benzenoid - Substituted pyrrole - Heteroaromatic compound - Pyrrole - Azacycle - Organobromide - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoylindoles. These are organic compounds containing an indole attached to a benzoyl moiety through the acyl group. |
| External Descriptors | Not available |
| Melt Point(°C) | 217 °C |
|---|---|
| Molecular Weight | 429.100 g/mol |
| XLogP3 | 6.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 428.919 Da |
| Monoisotopic Mass | 426.921 Da |
| Topological Polar Surface Area | 22.000 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 425.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |