Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
The complexation reaction of phenyl 2-pyridyl ketoxime with some transition and heavy metal ions Co2+, Ni2+, Zn2+, Pb2+, Fe2+, Fe3+, Cr3+ and La2+ has been studied potentiometrically. The reactions of phenyl(2-pyridyl)ketone oxime, with nickel(II) sulfate hexahydrate, in the absence of an external base, have been investigated.
| Pubchem Sid | 488184946 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488184946 |
| Canonical Smiles | C1=CC=C(C=C1)C(=NO)C2=CC=CC=N2 |
| IUPAC Name | N-[phenyl(pyridin-2-yl)methylidene]hydroxylamine |
| InChIKey | RSJDEVMJZLLAHS-UHFFFAOYSA-N |
| INCHI | 1S/C12H10N2O/c15-14-12(10-6-2-1-3-7-10)11-8-4-5-9-13-11/h1-9,15H |
| Isomeric SMILES | C1=CC=C(C=C1)C(=NO)C2=CC=CC=N2 |
| WGK Germany | 3 |
| PubChem CID | 74582 |
| Molecular Weight | 198.23 |
| Reaxy-Rn | 82985 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Benzene and substituted derivatives Ketoximes Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Benzenoid - Pyridine - Monocyclic benzene moiety - Heteroaromatic compound - Ketoxime - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
| Melt Point(°C) | 154-156 °C |
|---|---|
| Molecular Weight | 198.220 g/mol |
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 198.079 Da |
| Monoisotopic Mass | 198.079 Da |
| Topological Polar Surface Area | 45.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 1 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |