Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Advantages of the QuinoxP* Ligands:
It is not oxidized nor epimerized at ambient conditions in air
Enantioselectivities are outstanding for various reaction paradigms
Hydrogenations proceed under mild reaction conditions
Low catalyst loadings yield high TONs
Product Describtion:
(R,R)-(-)-2,3-Bis(tert-butylmethylphosphino)quinoxaline is an air-stable C2-symmetric P-stereogenic phosphine ligand.
| Canonical Smiles | CC(C)(C)P(C)C1=NC2=CC=CC=C2N=C1P(C)C(C)(C)C |
|---|---|
| IUPAC Name | tert-butyl-[3-[tert-butyl(methyl)phosphanyl]quinoxalin-2-yl]-methylphosphane |
| InChIKey | DRZBLHZZDMCPGX-UHFFFAOYSA-N |
| INCHI | 1S/C18H28N2P2/c1-17(2,3)21(7)15-16(22(8)18(4,5)6)20-14-12-10-9-11-13(14)19-15/h9-12H,1-8H3 |
| Isomeric SMILES | CC(C)(C)P(C)C1=NC2=CC=CC=C2N=C1P(C)C(C)(C)C |
| WGK Germany | 3 |
| PubChem CID | 16218188 |
| Molecular Weight | 334.38 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinoxalines |
| Alternative Parents | Pyrazines Benzenoids Heteroaromatic compounds Organic phosphines and derivatives Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinoxaline - Benzenoid - Pyrazine - Heteroaromatic compound - Phosphine - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organophosphorus compound - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinoxalines. These are compounds containing a quinoxaline moiety, a bicyclic heterocycle made up of a benzene ring fused to a pyrazine ring. |
| External Descriptors | Not available |
| Sensitivity | moisture sensitive;Air Sensitive |
|---|---|
| Specific Rotation[α] | -52° (C=1,CHCl3) |
| Melt Point(°C) | 102 °C |
| Molecular Weight | 334.400 g/mol |
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 334.173 Da |
| Monoisotopic Mass | 334.173 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 336.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |