Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1(=NC(=NC(=N1)Cl)Cl)[O-].[Na+] |
|---|---|
| IUPAC Name | sodium;4,6-dichloro-1,3,5-triazin-2-olate |
| InChIKey | SYWDUFAVIVYDMX-UHFFFAOYSA-M |
| INCHI | 1S/C3HCl2N3O.Na/c4-1-6-2(5)8-3(9)7-1;/h(H,6,7,8,9);/q;+1/p-1 |
| Molecular Weight | 187.940 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,3,5-triazines |
| Intermediate Tree Nodes | Halo-S-triazines |
| Direct Parent | Chloro-s-triazines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Organic metal halides Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Organic sodium salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Chloro-s-triazine - Aryl chloride - Aryl halide - Heteroaromatic compound - Organic metal halide - Organic alkali metal salt - Azacycle - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Organic sodium salt - Organic salt - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as chloro-s-triazines. These are aromatic compounds containing a 1,3,5-triazine ring that is substituted at the 2-position with a chlorine atom. |
| External Descriptors | Not available |
| Molecular Weight | 187.940 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 186.932 Da |
| Monoisotopic Mass | 186.932 Da |
| Topological Polar Surface Area | 61.700 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 97.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |