Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=CC2=C(C3=C(C=C2)C=C(N3)C(=O)O)N=C1 |
|---|---|
| IUPAC Name | 1H-pyrrolo[3,2-h]quinoline-2-carboxylic acid |
| InChIKey | NKRJTXAQMCUSEC-UHFFFAOYSA-N |
| INCHI | 1S/C12H8N2O2/c15-12(16)9-6-8-4-3-7-2-1-5-13-10(7)11(8)14-9/h1-6,14H,(H,15,16) |
| Isomeric SMILES | C1=CC2=C(C3=C(C=C2)C=C(N3)C(=O)O)N=C1 |
| Molecular Weight | 212.2 |
| Reaxy-Rn | 174981 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=174981&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Pyrroloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrroloquinolines |
| Alternative Parents | Indolecarboxylic acids and derivatives Indoles Pyrrole 2-carboxylic acids Substituted pyrroles Pyridines and derivatives Benzenoids Heteroaromatic compounds Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrroloquinoline - Indolecarboxylic acid derivative - Indole - Indole or derivatives - Pyrrole-2-carboxylic acid - Pyrrole-2-carboxylic acid or derivatives - Benzenoid - Substituted pyrrole - Pyridine - Heteroaromatic compound - Pyrrole - Azacycle - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Hydrocarbon derivative - Organonitrogen compound - Organooxygen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organic oxide - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrroloquinolines. These are compounds containing a pyrroloquinoline moiety, which consists of a pyrrole ring fused to a quinoline. |
| External Descriptors | Not available |
| Molecular Weight | 212.200 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 212.059 Da |
| Monoisotopic Mass | 212.059 Da |
| Topological Polar Surface Area | 66.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 295.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |