Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
Storage
Room temperature
Shipped In
Normal
| Canonical Smiles | CS(=O)(=O)C1=C(C=C(C=C1)C=O)C#N |
|---|---|
| IUPAC Name | 5-formyl-2-methylsulfonylbenzonitrile |
| InChIKey | UQKVJFMEGXYHTR-UHFFFAOYSA-N |
| INCHI | 1S/C9H7NO3S/c1-14(12,13)9-3-2-7(6-11)4-8(9)5-10/h2-4,6H,1H3 |
| Isomeric SMILES | CS(=O)(=O)C1=C(C=C(C=C1)C=O)C#N |
| PubChem CID | 56773893 |
| Molecular Weight | 209.23 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonyl compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonyl compounds |
| Alternative Parents | Benzoyl derivatives Benzonitriles Benzaldehydes Sulfones Nitriles Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonyl group - Benzaldehyde - Benzonitrile - Benzoyl - Aryl-aldehyde - Sulfonyl - Sulfone - Carbonitrile - Nitrile - Aldehyde - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Cyanide - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonyl compounds. These are aromatic compounds containing a benzenesulfonyl group, which consists of a monocyclic benzene moiety that carries a sulfonyl group. |
| External Descriptors | Not available |
| Molecular Weight | 209.220 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 209.015 Da |
| Monoisotopic Mass | 209.015 Da |
| Topological Polar Surface Area | 83.400 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 359.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |