Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C)(CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)Cl |
|---|---|
| IUPAC Name | chloro-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| InChIKey | IHMWVSNXULAOAZ-UHFFFAOYSA-N |
| INCHI | 1S/C8H10ClF9Si/c1-19(2,9)4-3-5(10,11)6(12,13)7(14,15)8(16,17)18/h3-4H2,1-2H3 |
| Isomeric SMILES | C[Si](C)(CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)Cl |
| Alternate CAS | 119386-82-2 |
| PubChem CID | 4623365 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes - Trialkylheterosilanes |
| Direct Parent | Trialkylchlorosilanes |
| Alternative Parents | Silyl monohalides Organochlorosilanes Organic metalloid salts Alkylhalosilanes Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylchlorosilane - Silyl monohalide - Organochlorosilane - Organic metalloid salt - Alkylhalosilane - Hydrocarbon derivative - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylchlorosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one chlorine atom. |
| External Descriptors | Not available |
| Molecular Weight | 340.690 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 5 |
| Exact Mass | 340.01 Da |
| Monoisotopic Mass | 340.01 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 323.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |