≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Polyene cyclization, oxymercuration, catalytic hydration of alkynes, catalytic hydrative enyne cyclization, catalytic arylyne cyclization, catalytic biomimetic tandem cyclization, catalyticketoalkyne cyclization leading to furans, catalytic cyclization of propargyl tert-butyl carbonates leading to cyclic carbonates, catalytic cycloisomerization of alkynyl aniline derivatives leading toindoles, catalytic alkynoic acid cyclization leading to lactones, catalytic glycosylation.
| Pubchem Sid | 504761903 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504761903 |
| Canonical Smiles | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| IUPAC Name | mercury(2+);trifluoromethanesulfonate |
| InChIKey | BPVYMDMPLCOQPJ-UHFFFAOYSA-L |
| INCHI | 1S/2CHF3O3S.Hg/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| Isomeric SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| WGK Germany | 3 |
| UN Number | 2025 |
| Molecular Weight | 498.73 |
| Reaxy-Rn | 4028199 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4028199&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic sulfonic acids and derivatives |
| Subclass | Organosulfonic acids and derivatives |
| Intermediate Tree Nodes | Alkanesulfonic acids and derivatives - Alkanesulfonic acids |
| Direct Parent | Trifluoromethanesulfonates |
| Alternative Parents | Sulfonyls Organosulfonic acids Methanesulfonates Trihalomethanes Organic transition metal salts Organic metal halides Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Not available |
| Substituents | Trifluoromethanesulfonate - Methanesulfonate - Organosulfonic acid - Sulfonyl - Trihalomethane - Organic metal halide - Organic transition metal salt - Alkyl fluoride - Hydrocarbon derivative - Organic salt - Halomethane - Organic oxide - Organosulfur compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Alkyl halide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trifluoromethanesulfonates. These are alkanesulfonic acids, that contain a sulfonate group that is substituted with a trifluoromethyl group. |
| External Descriptors | Not available |
| Melt Point(°C) | >350°C |
|---|---|
| Molecular Weight | 498.700 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 0 |
| Exact Mass | 499.875 Da |
| Monoisotopic Mass | 499.875 Da |
| Topological Polar Surface Area | 131.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 145.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
L2205646