Determine the necessary mass, volume, or concentration for preparing a solution.
≥99.995% metals basis for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Alq3 crystals exist in two isomeric states, meridional and facial isomers. A third isomeric state ( γ) was studied by X-ray diffraction, the δ-Alq3 transforms into γ-form at ~180°C. Mechanism of the Alq3 phosphorescence has been studied.
| Pubchem Sid | 504768489 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768489 |
| Canonical Smiles | C1=CC2=C(C(=C1)O[Al](OC3=CC=CC4=C3N=CC=C4)OC5=CC=CC6=C5N=CC=C6)N=CC=C2 |
| IUPAC Name | tri(quinolin-8-yloxy)alumane |
| InChIKey | TVIVIEFSHFOWTE-UHFFFAOYSA-K |
| INCHI | 1S/3C9H7NO.Al/c3*11-8-5-1-3-7-4-2-6-10-9(7)8;/h3*1-6,11H;/q;;;+3/p-3 |
| Isomeric SMILES | C1=CC2=C(C(=C1)O[Al](OC3=CC=CC4=C3N=CC=C4)OC5=CC=CC6=C5N=CC=C6)N=CC=C2 |
| WGK Germany | 3 |
| RTECS | BD2231000 |
| PubChem CID | 16683111 |
| Molecular Weight | 459.43 |
| Reaxy-Rn | 4163930 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinolines and derivatives |
| Alternative Parents | Pyridines and derivatives Benzenoids Heteroaromatic compounds Organic metal salts Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinoline - Benzenoid - Pyridine - Heteroaromatic compound - Azacycle - Organic metal salt - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Organooxygen compound - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinolines and derivatives. These are compounds containing a quinoline moiety, which consists of a benzene ring fused to a pyrimidine ring to form benzo[b]azabenzene. |
| External Descriptors | Not available |
| Solubility | Solubility in chloroform |
|---|---|
| Melt Point(°C) | >300°C |
| Molecular Weight | 459.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 459.116 Da |
| Monoisotopic Mass | 459.116 Da |
| Topological Polar Surface Area | 66.400 Ų |
| Heavy Atom Count | 34 |
| Formal Charge | 0 |
| Complexity | 571.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |