Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504756753 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756753 |
| Canonical Smiles | CO[Si](CCCN1C=CN=C1)(OC)OC |
| IUPAC Name | 3-imidazol-1-ylpropyl(trimethoxy)silane |
| InChIKey | LLIFKTIQXYJAHL-UHFFFAOYSA-N |
| INCHI | 1S/C9H18N2O3Si/c1-12-15(13-2,14-3)8-4-6-11-7-5-10-9-11/h5,7,9H,4,6,8H2,1-3H3 |
| Isomeric SMILES | CO[Si](CCCN1C=CN=C1)(OC)OC |
| Molecular Weight | 230.34 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Alkoxysilanes |
| Direct Parent | Trialkoxysilanes |
| Alternative Parents | N-substituted imidazoles Heteroaromatic compounds Silyl ethers Organoheterosilanes Organic metalloid salts Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Trialkoxysilane - N-substituted imidazole - Azole - Imidazole - Heteroaromatic compound - Silyl ether - Organoheterosilane - Azacycle - Organic metalloid salt - Organoheterocyclic compound - Organic nitrogen compound - Organic salt - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkoxysilanes. These are organosilicon compounds with the general formula RO[Si](R')(OR'')OR''' (R-R''' = aliphatic organyl group). |
| External Descriptors | Not available |
| Sensitivity | Moisture sensitive |
|---|---|
| Flash Point(°C) | 129 °C |
| Boil Point(°C) | 127 °C/1.7 mmHg |
| Molecular Weight | 230.340 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Exact Mass | 230.109 Da |
| Monoisotopic Mass | 230.109 Da |
| Topological Polar Surface Area | 45.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 170.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zhuoxue Li, Yunlei Shi, Yimian Ding, Dazhen Xiong, Zhiyong Li, Huiyong Wang, Jikuan Qiu, Xiaopeng Xuan, Jianji Wang. (2024) Zr-Based MOF-Stabilized CO2-Responsive Pickering Emulsions for Efficient Reduction of Nitroarenes. LANGMUIR, [PMID:38307089] [10.1021/acs.langmuir.3c03564] |