Determine the necessary mass, volume, or concentration for preparing a solution.
≥90%, With 100ppm MEHQ stabilizer for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(=C)C(=O)OCCCCOC(=O)C(=C)C |
|---|---|
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| InChIKey | XOJWAAUYNWGQAU-UHFFFAOYSA-N |
| INCHI | 1S/C12H18O4/c1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4/h1,3,5-8H2,2,4H3 |
| Isomeric SMILES | CC(=C)C(=O)OCCCCOC(=O)C(=C)C |
| WGK Germany | 1 |
| Molecular Weight | 226.27 |
| Reaxy-Rn | 1782778 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1782778&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Dicarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dicarboxylic acids and derivatives |
| Alternative Parents | Enoate esters Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dicarboxylic acid or derivatives - Alpha,beta-unsaturated carboxylic ester - Enoate ester - Carboxylic acid ester - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. |
| External Descriptors | Not available |
| Sensitivity | sensitive to light; sensitive to heat |
|---|---|
| Refractive Index | 1.456 |
| Flash Point(°F) | 235.4 °F |
| Flash Point(°C) | 113 °C |
| Boil Point(°C) | 132-134°C/4mmHg |
| Melt Point(°C) | −117 °C(lit.) |
| Molecular Weight | 226.270 g/mol |
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 9 |
| Exact Mass | 226.121 Da |
| Monoisotopic Mass | 226.121 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 261.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jing Neng, Yazhi Wang, Yilong Zhang, Peng Chen, Kai Yang. (2023) MIPs–SERS Sensor Based on Ag NPs Film for Selective Detection of Enrofloxacin in Food. Biosensors-Basel, 13 (3): (330). [PMID:36979542] [10.3390/bios13030330] |
| 2. Li Lute, Wang Xiwen, Yang Jin. (2025) Preparation and performance study of modified cellulose-based polymer absorbents. JOURNAL OF POLYMER RESEARCH, 32 (6): (1-20). [PMID:] [10.1007/s10965-025-04439-4] |
| 3. Yifeng Chen, Qijun Wu, Wenzhong Cao, Haonan He, Minmin Ding, Xianchi Zhou, Xinyi Li, Shaohua Jiang, Peng Zhang, Jian Ji. (2025) Fiber-reinforced zwitterionic elastomer composites for artificial heart valves. Journal of Materials Chemistry B, [PMID:40462524] [10.1039/D5TB00980D] |