Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
|---|---|
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanamide |
| InChIKey | ATJMLNAMXAIUCX-UHFFFAOYSA-N |
| INCHI | 1S/C6H2F11NO/c7-2(8,1(18)19)3(9,10)4(11,12)5(13,14)6(15,16)17/h(H2,18,19) |
| Isomeric SMILES | C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
| PubChem CID | 14569599 |
| Molecular Weight | 313.07 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Alkyl halides |
| Subclass | Alkyl fluorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Perfluoroalkyl carboxylic acid and derivatives |
| Alternative Parents | Fatty amides Primary carboxylic acid amides Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Perfluoroalkyl carboxylic acid or derivatives - Fatty acyl - Fatty amide - Primary carboxylic acid amide - Carboxamide group - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as perfluoroalkyl carboxylic acid and derivatives. These are organic compounds containing an alkyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the alkyl chain are replaced by fluorine atoms. |
| External Descriptors | Not available |
| Melt Point(°C) | 120-122 |
|---|---|
| Molecular Weight | 313.070 g/mol |
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 4 |
| Exact Mass | 312.996 Da |
| Monoisotopic Mass | 312.996 Da |
| Topological Polar Surface Area | 43.100 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 370.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |