average Mₙ 670 for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Surfactant.Reduces surface tension; wetting agent, defoamer, and emulsifier for emulsion polymerization.
| Canonical Smiles | CC(C)CC(C)(C#CC(C)(CC(C)C)O)O.C(CO)O |
|---|---|
| IUPAC Name | ethane-1,2-diol;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
| InChIKey | SUHUKEQAOUOUJO-UHFFFAOYSA-N |
| INCHI | 1S/C14H26O2.C2H6O2/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4;3-1-2-4/h11-12,15-16H,9-10H2,1-6H3;3-4H,1-2H2 |
| Isomeric SMILES | CC(C)CC(C)(C#CC(C)(CC(C)C)O)O.C(CO)O |
| WGK Germany | 2 |
| PubChem CID | 16213030 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Alpha,beta-unsaturated carbonyl compounds - Alpha,beta-unsaturated ketones |
| Direct Parent | Ynones |
| Alternative Parents | Tertiary alcohols Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Ynone - Tertiary alcohol - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as ynones. These are organic compounds containing the ynone functional group, an alpha,beta unsaturated ketone group with the general structure RC#C-C(=O)R' (R' not H). |
| External Descriptors | Not available |
| Solubility | carbon tetrachloride, xylene and ethylene glycol: soluble |
|---|---|
| Refractive Index | 1.468 |
| Boil Point(°C) | >121 °C |
| Molecular Weight | 288.420 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Exact Mass | 288.23 Da |
| Monoisotopic Mass | 288.23 Da |
| Topological Polar Surface Area | 80.900 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 262.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Xinze Li, Ling Zhang, Yibo Li, Longxin Liu, Ruitao Wang, Hualei Zhou, Donghai Zhang. (2024) Preparation and Properties Improvement of Decynediol-Ethoxylate-Modified Trisiloxane Surfactant. LANGMUIR, [PMID:39365841] [10.1021/acs.langmuir.4c02770] |
