Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504771984 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771984 |
| Canonical Smiles | C1C2=CC=CC=C2CC1(N)P(=O)(O)O.Cl |
| IUPAC Name | (2-amino-1,3-dihydroinden-2-yl)phosphonic acid;hydrochloride |
| InChIKey | VZZDWKUDNIOOBD-UHFFFAOYSA-N |
| INCHI | 1S/C9H12NO3P.ClH/c10-9(14(11,12)13)5-7-3-1-2-4-8(7)6-9;/h1-4H,5-6,10H2,(H2,11,12,13);1H |
| Isomeric SMILES | C1C2=CC=CC=C2CC1(N)P(=O)(O)O.Cl |
| PubChem CID | 70700922 |
| Molecular Weight | 249.63 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Indanes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indanes |
| Alternative Parents | Organic phosphonic acids Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Indane - Organophosphonic acid derivative - Organophosphonic acid - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Hydrochloride - Organophosphorus compound - Organonitrogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as indanes. These are compounds containing an indane moiety, which consists of a cyclopentane fused to a benzene ring. |
| External Descriptors | Not available |
| Molecular Weight | 249.630 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 249.032 Da |
| Monoisotopic Mass | 249.032 Da |
| Topological Polar Surface Area | 83.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 261.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Sun Wenda, Liu Qiao, Chen Huilin, Xie Xiaofang, Zhang Zhuan, Zeng Yu, Zhou Jianuan, Zhou Xiaofan, Jiang Xianya, Liang Zhibin, Li Jian-Feng, Deng Yizhen. (2025) Rice phyllospheric Pantoea spp. suppress blast and bacterial blight diseases. Environmental Microbiome, 20 (1): (1-18). [PMID:41204312] [10.1186/s40793-025-00799-y] |