Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Application
α,α,α′,α′-Tetrabromo-o-xylene can be employed as a precursor for the synthesis of:Poly(o-phenylene vinylene) (o-PPV) via electrochemical polymerization.
A pentacene derivative by reacting with naphthalene moieties for the development of organic thin-film transistors (OTFTs).
Bitopic pyrazole containing ligands.
| Canonical Smiles | C1=CC=C(C(=C1)C(Br)Br)C(Br)Br |
|---|---|
| IUPAC Name | 1,2-bis(dibromomethyl)benzene |
| InChIKey | LNAOKZKISWEZNY-UHFFFAOYSA-N |
| INCHI | 1S/C8H6Br4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,7-8H |
| Isomeric SMILES | C1=CC=C(C(=C1)C(Br)Br)C(Br)Br |
| WGK Germany | 3 |
| PubChem CID | 83234 |
| Molecular Weight | 421.75 |
| Beilstein | 2211700 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | Organobromides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Monocyclic benzene moiety - Hydrocarbon derivative - Organobromide - Organohalogen compound - Alkyl halide - Alkyl bromide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
| External Descriptors | Not available |
| Solubility | Insoluble in water |
|---|---|
| Sensitivity | Light Sensitive |
| Refractive Index | 1.685 |
| Flash Point(°C) | 157.8ºC |
| Boil Point(°C) | 343.9ºC at 760 mmHg |
| Melt Point(°C) | 114-118℃ |
| Molecular Weight | 421.750 g/mol |
| XLogP3 | 4.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 2 |
| Exact Mass | 421.716 Da |
| Monoisotopic Mass | 417.72 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 119.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |