Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CCCCC[Sn](CCCCC)(CCCCC)Cl |
|---|---|
| IUPAC Name | chloro(tripentyl)stannane |
| InChIKey | LKGICXFRDGZQHA-UHFFFAOYSA-M |
| INCHI | 1S/3C5H11.ClH.Sn/c3*1-3-5-4-2;;/h3*1,3-5H2,2H3;1H;/q;;;;+1/p-1 |
| Isomeric SMILES | CCCCC[Sn](CCCCC)(CCCCC)Cl |
| PubChem CID | 134536 |
| Molecular Weight | 367.59 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Class | Organic metal salts |
| Subclass | Organic post-transition metal salts |
| Intermediate Tree Nodes | Organic tin salts |
| Direct Parent | Triorganotin halide salts |
| Alternative Parents | Trialkyltins Metal alkyl halides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Triorganotin halide salt - Trialkyltin - Metal alkyl halide - Hydrocarbon derivative - Organotin compound - Organometallic compound - Organic post-transition metal moeity - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as triorganotin halide salts. These are organic compounds containing a tin atom bonded to three carbon atoms and a halogen atom. |
| External Descriptors | Not available |
| Molecular Weight | 367.600 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 12 |
| Exact Mass | 368.129 Da |
| Monoisotopic Mass | 368.129 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 132.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |