≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488189923 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488189923 |
| Canonical Smiles | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Cu+2] |
| IUPAC Name | copper;N,N-dimethylcarbamodithioate |
| InChIKey | ZOUQIAGHKFLHIA-UHFFFAOYSA-L |
| INCHI | 1S/2C3H7NS2.Cu/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
| Isomeric SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Cu+2] |
| RTECS | FA0175000 |
| Molecular Weight | 303.96 |
| Beilstein | 4(4)234 |
| Reaxy-Rn | 3915474 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3915474&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Class | Organic metal salts |
| Subclass | Organic transition metal salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic transition metal salts |
| Alternative Parents | Organosulfur compounds Organopnictogen compounds Organonitrogen compounds Organic copper salts Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Organic transition metal salt - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic copper salt - Organosulfur compound - Organonitrogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organic transition metal salts. These are organic salt compounds containing a transition metal atom in its ionic form. |
| External Descriptors | Not available |
| Molecular Weight | 304.000 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 302.918 Da |
| Monoisotopic Mass | 302.918 Da |
| Topological Polar Surface Area | 72.700 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 54.300 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
D1727036