Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Application
Di-p-tolyl ether is used to form conformationally chiral molecules in the solid state, while the chirality of 1,3-dimethyl-2-phenoxybenzene arises from the formation of supramolecular helices.
| Pubchem Sid | 488184867 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488184867 |
| Canonical Smiles | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C |
| IUPAC Name | 1-methyl-4-(4-methylphenoxy)benzene |
| InChIKey | YWYHGNUFMPSTTR-UHFFFAOYSA-N |
| INCHI | 1S/C14H14O/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| Isomeric SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C |
| WGK Germany | 2 |
| RTECS | DA6625000 |
| Molecular Weight | 198.27 |
| Reaxy-Rn | 909358 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=909358&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylethers |
| Alternative Parents | Diarylethers Phenoxy compounds Phenol ethers Toluenes Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylether - Diaryl ether - Phenoxy compound - Phenol ether - Toluene - Ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylethers. These are aromatic compounds containing two benzene rings linked to each other through an ether group. |
| External Descriptors | Not available |
| Solubility | Soluble in acetone, benzene, ether |
|---|---|
| Flash Point(°F) | >235.4 °F |
| Flash Point(°C) | >113 °C |
| Boil Point(°C) | 285°C(lit.) |
| Melt Point(°C) | 48 °C |
| Molecular Weight | 198.260 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 198.104 Da |
| Monoisotopic Mass | 198.104 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 154.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Shang Ke Yang, Zhao Xin Zhang, Ai Ping Zhang, Hai Lan Lin, Xun Tao Zhang, Liu Xin Xiao, Jun Bian, Dai Qiang Chen. (2022) Preparation and properties of polyimide dielectric nanocomposites containing polyvinylpyrrolidone chemically functionalized barium titanate by in-situ synthesis compounding. JOURNAL OF APPLIED POLYMER SCIENCE, 139 (48): (e53231). [PMID:] [10.1002/app.53231] |