Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Desiccated Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
DMABA NHS ester is a reagent that reacts with the primary amine group of PE lipids.
| Canonical Smiles | CN(C)C1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O |
|---|---|
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(dimethylamino)benzoate |
| InChIKey | FNGFZOAQGYOQTG-UHFFFAOYSA-N |
| INCHI | 1S/C13H14N2O4/c1-14(2)10-5-3-9(4-6-10)13(18)19-15-11(16)7-8-12(15)17/h3-6H,7-8H2,1-2H3 |
| Isomeric SMILES | CN(C)C1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O |
| PubChem CID | 71312544 |
| Molecular Weight | 262.26 |
| Beilstein | 1479401 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminobenzoic acids and derivatives |
| Alternative Parents | Dialkylarylamines Benzoyl derivatives Aniline and substituted anilines Pyrrolidine-2-ones Dicarboximides Lactams Amino acids and derivatives Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminobenzoic acid or derivatives - Benzoyl - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Pyrrolidone - 2-pyrrolidone - Pyrrolidine - Dicarboximide - Tertiary amine - Amino acid or derivatives - Lactam - Organoheterocyclic compound - Azacycle - Carboxylic acid derivative - Organic oxide - Organonitrogen compound - Organooxygen compound - Amine - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminobenzoic acids and derivatives. These are benzoic acids (or derivative thereof) containing an amine group attached to the benzene moiety. |
| External Descriptors | Not available |
| Molecular Weight | 262.260 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 262.095 Da |
| Monoisotopic Mass | 262.095 Da |
| Topological Polar Surface Area | 66.900 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 370.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |