Determine the necessary mass, volume, or concentration for preparing a solution.
1000ug/ml in Purge and Trap Methanol for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Pesticides Single Component Standards
| Canonical Smiles | CN1C(=NC(=O)N(C1=O)C2CCCCC2)N(C)C |
|---|---|
| IUPAC Name | 3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4-dione |
| InChIKey | CAWXEEYDBZRFPE-UHFFFAOYSA-N |
| INCHI | 1S/C12H20N4O2/c1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3 |
| Isomeric SMILES | CN1C(=NC(=O)N(C1=O)C2CCCCC2)N(C)C |
| WGK Germany | 3 |
| RTECS | XY7850000 |
| Molecular Weight | 252.31 |
| Beilstein | 618801 |
| Reaxy-Rn | 618801 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=618801&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines - Tertiary alkylarylamines |
| Direct Parent | Dialkylarylamines |
| Alternative Parents | Triazinones N-aliphatic s-triazines 1,3,5-triazines Heteroaromatic compounds Ureas Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Dialkylarylamine - Amino-1,3,5-triazine - Aminotriazine - Triazinone - N-aliphatic s-triazine - Triazine - 1,3,5-triazine - Heteroaromatic compound - Urea - Organoheterocyclic compound - Azacycle - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkylarylamines. These are aliphatic aromatic amines in which the amino group is linked to two aliphatic chains and one aromatic group. |
| External Descriptors | Triazinone herbicides |
| Melt Point(°C) | 115-117°C |
|---|---|
| Molecular Weight | 252.310 g/mol |
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 252.159 Da |
| Monoisotopic Mass | 252.159 Da |
| Topological Polar Surface Area | 56.200 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 386.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xin Liu, Shiyue Niu, Bin Yang, Jia Liu, Liqian Niu, Xian Wang, Daqian Song, Shuyun Bi. (2025) Fabrication of BSA-protected AgNPs modified MIL-53(Al) as SERS substrate for trace determination of diquat and dipterex. TALANTA, [PMID:40154046] [10.1016/j.talanta.2025.128002] |