| Canonical Smiles | CC1(COC(C(C1NC)O)OC2C(CC(C(C2O)OC3C(C(C(C(O3)CN)O)O)O)N)NC(=O)C(CN)O)O.OS(=O)(=O)O |
|---|---|
| IUPAC Name | (2S)-3-amino-N-[(1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(2R,3R,4R,5R)-3,5-dihydroxy-5-methyl-4-(methylamino)oxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxypropanamide;sulfuric acid |
| InChIKey | DDXRHRXGIWOVDQ-MGAUJLSLSA-N |
| INCHI | 1S/C22H43N5O12.H2O4S/c1-22(35)6-36-20(15(33)18(22)26-2)39-17-8(27-19(34)9(28)4-23)3-7(25)16(14(17)32)38-21-13(31)12(30)11(29)10(5-24)37-21;1-5(2,3)4/h7-18,20-21,26,28-33,35H,3-6,23-25H2,1-2H3,(H,27,34);(H2,1,2,3,4)/t7-,8+,9-,10+,11+,12-,13+,14-,15+,16+,17-,18+,20+,21+,22-;/m0./s1 |
| Isomeric SMILES | C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N)NC(=O)[C@H](CN)O)O.OS(=O)(=O)O |
| PubChem CID | 636375 |
| Molecular Weight | 569.609808 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Aminosaccharides - Aminoglycosides - Aminocyclitol glycosides |
| Direct Parent | 2-deoxystreptamine aminoglycosides |
| Alternative Parents | Beta amino acids and derivatives O-glycosyl compounds Aminocyclitols and derivatives Cyclohexanols Cyclohexylamines Oxanes Monosaccharides Organic sulfuric acids Tertiary alcohols 1,2-aminoalcohols Secondary carboxylic acid amides Oxacyclic compounds Acetals Dialkylamines Polyols Monoalkylamines Hydrocarbon derivatives Carbonyl compounds Organic oxides Organopnictogen compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | 2-deoxystreptamine aminoglycoside - O-glycosyl compound - Beta amino acid or derivatives - Glycosyl compound - Aminocyclitol or derivatives - Sulfuric acid - Cyclohexylamine - Cyclohexanol - Monosaccharide - Cyclitol or derivatives - Oxane - Organic sulfuric acid or derivatives - Tertiary alcohol - Cyclic alcohol - Amino acid or derivatives - 1,2-aminoalcohol - Secondary carboxylic acid amide - Carboxamide group - Secondary alcohol - Acetal - Oxacycle - Organoheterocyclic compound - Carboxylic acid derivative - Secondary amine - Polyol - Secondary aliphatic amine - Alcohol - Carbonyl group - Organic nitrogen compound - Hydrocarbon derivative - Amine - Primary amine - Organopnictogen compound - Organic oxide - Organonitrogen compound - Primary aliphatic amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-deoxystreptamine aminoglycosides. These are aminoglycosides containing the 2-deoxystreptamine (1,3-diaminocyclohexane-4,5,6-triol) core. |
| External Descriptors | Not available |
| Molecular Weight | 667.700 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 14 |
| Hydrogen Bond Acceptor Count | 20 |
| Rotatable Bond Count | 9 |
| Exact Mass | 667.258 Da |
| Monoisotopic Mass | 667.258 Da |
| Topological Polar Surface Area | 381.000 Ų |
| Heavy Atom Count | 44 |
| Formal Charge | 0 |
| Complexity | 899.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 15 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
