≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Ms-PEG2-t-butyl ester is a PEG derivative containing a mesyl group and a t-butyl protecting group. The mesyl group is a good leaving group for nucleophilic substitution reactions. The t-butyl is an acid labile protecting group. Upon removal, the carboxylic acid can be reacted with primary amines. The hydrophilic PEG linker increases the water solubility of the compound in aqueous media.
| Canonical Smiles | CC(C)(C)OC(=O)CCOCCOCCOS(=O)(=O)C |
|---|---|
| IUPAC Name | tert-butyl 3-[2-(2-methylsulfonyloxyethoxy)ethoxy]propanoate |
| InChIKey | SXMMBKJCRVIEEX-UHFFFAOYSA-N |
| INCHI | 1S/C12H24O7S/c1-12(2,3)19-11(13)5-6-16-7-8-17-9-10-18-20(4,14)15/h5-10H2,1-4H3 |
| Isomeric SMILES | CC(C)(C)OC(=O)CCOCCOCCOS(=O)(=O)C |
| PubChem CID | 60146179 |
| Molecular Weight | 312.37 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Solubility | Solubility in DMSO, DCM, DMF |
|---|---|
| Molecular Weight | 312.380 g/mol |
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 12 |
| Exact Mass | 312.124 Da |
| Monoisotopic Mass | 312.124 Da |
| Topological Polar Surface Area | 96.500 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 364.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
