Determine the necessary mass, volume, or concentration for preparing a solution.
0.5 M in methyl tert-butyl ether for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Application
Strong base for kinetically controlled deprotonations.
| Canonical Smiles | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
|---|---|
| IUPAC Name | sodium;bis(trimethylsilyl)azanide |
| InChIKey | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| INCHI | 1S/C6H18NSi2.Na/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| Isomeric SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| WGK Germany | 3 |
| PubChem CID | 2724254 |
| UN Number | 3263 |
| Packing Group | II |
| Molecular Weight | 183.37 |
| Beilstein | 3629917 |
| Reaxy-Rn | 3629917 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes |
| Direct Parent | Trialkylheterosilanes |
| Alternative Parents | Organic metalloid salts N-silyl compounds Organic sodium salts Organic nitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylheterosilane - N-silyl compound - Organic alkali metal salt - Organic metalloid salt - Organic nitrogen compound - Hydrocarbon derivative - Organic sodium salt - Organic salt - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylheterosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one heteroatom. |
| External Descriptors | Not available |
| Flash Point(°F) | 1 °F |
|---|---|
| Flash Point(°C) | -17 °C |
| Melt Point(°C) | 171-175°C |
| Molecular Weight | 183.370 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 183.088 Da |
| Monoisotopic Mass | 183.088 Da |
| Topological Polar Surface Area | 1.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 80.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Xinyan Yu, Yong Wang, Yutong Dong, Ning Zhao, Lifeng Zhang, Sunting Xuan, Zhengbiao Zhang. (2023) Efficient Synthesis of N-Methyl Polypeptides by Organic Acid Promoted Controlled Ring-Opening Polymerization of N-Methyl-α-Amino Acids N-Carboxyanhydrides. MACROMOLECULES, [PMID:] [10.1021/acs.macromol.3c01102] |