for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Application：
Reactant for:
Isomerization reactions
Preparation of catechol derivatives as fluorescent chemosensors for wide-range pH detection
Preparation of naphthalene derivatives as human cytomegalovirus (HCMV) protease inhibitors
| Pubchem Sid | 488199179 |
|---|---|
| Canonical Smiles | C1=CC=C(C=C1)[P+](CC2=CC=CC=N2)(C3=CC=CC=C3)C4=CC=CC=C4.Cl.[Cl-] |
| IUPAC Name | triphenyl(pyridin-2-ylmethyl)phosphanium;chloride;hydrochloride |
| InChIKey | JHQWTRCLYUFMSJ-UHFFFAOYSA-M |
| INCHI | 1S/C24H21NP.2ClH/c1-4-13-22(14-5-1)26(23-15-6-2-7-16-23,24-17-8-3-9-18-24)20-21-12-10-11-19-25-21;;/h1-19H,20H2;2*1H/q+1;;/p-1 |
| Isomeric SMILES | C1=CC=C(C=C1)[P+](CC2=CC=CC=N2)(C3=CC=CC=C3)C4=CC=CC=C4.Cl.[Cl-] |
| WGK Germany | 3 |
| PubChem CID | 16213046 |
| Molecular Weight | 426.32 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylphosphines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylphosphines and derivatives |
| Alternative Parents | Pyridines and derivatives Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organophosphorus compounds Organonitrogen compounds Organic zwitterions Organic chloride salts Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Triphenylphosphine - Phenylphosphine - Pyridine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic chloride salt - Hydrochloride - Organic salt - Organic zwitterion - Hydrocarbon derivative - Organopnictogen compound - Organic nitrogen compound - Organophosphorus compound - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylphosphines and derivatives. These are compounds containing a phenylphosphine, which consists of phosphine substituent bound to a phenyl group. |
| External Descriptors | Not available |
| Sensitivity | Moisture sensitive. |
|---|---|
| Melt Point(°C) | 249-254 °C (lit.) |
| Molecular Weight | 426.300 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 5 |
| Exact Mass | 425.087 Da |
| Monoisotopic Mass | 425.087 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 359.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
C2311627