Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
PI3 kinase inhibitors; PI3 kinase inhibitors;
| ALogP | -0.246 |
|---|---|
| HBD Count | 1 |
| Rotatable Bond | 1 |
| Canonical Smiles | CC1=C(C2=C(O1)N=CNC2=O)C(=O)O |
|---|---|
| IUPAC Name | 6-methyl-4-oxo-3H-furo[2,3-d]pyrimidine-5-carboxylic acid |
| InChIKey | FUUXILGTYMNJST-UHFFFAOYSA-N |
| INCHI | 1S/C8H6N2O4/c1-3-4(8(12)13)5-6(11)9-2-10-7(5)14-3/h2H,1H3,(H,12,13)(H,9,10,11) |
| Isomeric SMILES | CC1=C(C2=C(O1)N=CNC2=O)C(=O)O |
| PubChem CID | 4962030 |
| Molecular Weight | 194.14424 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Furo[2,3-d]pyrimidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Furo[2,3-d]pyrimidines |
| Alternative Parents | Furoic acids Furan-3-carboxylic acids Pyrimidones Heteroaromatic compounds Lactams Oxacyclic compounds Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Furo[2,3-d]pyrimidine - Furoic acid or derivatives - Furan-3-carboxylic acid - Furan-3-carboxylic acid or derivatives - Furoic acid - Pyrimidone - Pyrimidine - Furan - Heteroaromatic compound - Lactam - Oxacycle - Azacycle - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxide - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as furo[2,3-d]pyrimidines. These are aromatic heteropolycyclic compounds containing a furo[2,3-d]pyrimidine ring system, which is a furopyrimidine isomer having the on ring oxygen atom, and 2 nitrogen atoms at the 1-, 5-, and 7-positions, respectively. |
| External Descriptors | Not available |
| DMSO(mM) Max Solubility | 10 |
|---|---|
| Molecular Weight | 194.140 g/mol |
| XLogP3 | 0.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 194.033 Da |
| Monoisotopic Mass | 194.033 Da |
| Topological Polar Surface Area | 91.900 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 314.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |