Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(C(C(F)(F)Cl)(F)Cl)(C(F)(F)I)(F)F |
|---|---|
| IUPAC Name | 1,2-dichloro-1,1,2,3,3,4,4-heptafluoro-4-iodobutane |
| InChIKey | YRAAQTPTEGTGOK-UHFFFAOYSA-N |
| INCHI | 1S/C4Cl2F7I/c5-1(7,3(6,10)11)2(8,9)4(12,13)14 |
| Isomeric SMILES | C(C(C(F)(F)Cl)(F)Cl)(C(F)(F)I)(F)F |
| PubChem CID | 10926968 |
| Molecular Weight | 378.84 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Organoiodides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organoiodides |
| Alternative Parents | Organofluorides Organochlorides Hydrocarbon derivatives Alkyl iodides Alkyl fluorides Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hydrocarbon derivative - Organoiodide - Organofluoride - Organochloride - Alkyl iodide - Alkyl halide - Alkyl fluoride - Alkyl chloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organoiodides. These are compounds containing a chemical bond between a carbon atom and an iodine atom. |
| External Descriptors | Not available |
| Molecular Weight | 378.840 g/mol |
|---|---|
| XLogP3 | 4.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 377.831 Da |
| Monoisotopic Mass | 377.831 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |