≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=C(OC(=C1)Br)[N+](=O)[O-] |
|---|---|
| IUPAC Name | 2-bromo-5-nitrofuran |
| InChIKey | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
| INCHI | 1S/C4H2BrNO3/c5-3-1-2-4(9-3)6(7)8/h1-2H |
| Isomeric SMILES | C1=C(OC(=C1)Br)[N+](=O)[O-] |
| Molecular Weight | 191.97 |
| Reaxy-Rn | 120954 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=120954&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Furans |
| Subclass | Nitrofurans |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrofurans |
| Alternative Parents | Nitroaromatic compounds Aryl bromides Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Oxacyclic compounds Organic oxoazanium compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - 2-nitrofuran - Aryl bromide - Aryl halide - Heteroaromatic compound - C-nitro compound - Organic nitro compound - Organic oxoazanium - Oxacycle - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organobromide - Hydrocarbon derivative - Organohalogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrofurans. These are compounds containing a furan ring which bears a nitro group. |
| External Descriptors | Not available |
| Sensitivity | Light Sensitive |
|---|---|
| Boil Point(°C) | 118°C/15mmHg(lit.) |
| Melt Point(°C) | 47 °C |
| Molecular Weight | 191.970 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 190.922 Da |
| Monoisotopic Mass | 190.922 Da |
| Topological Polar Surface Area | 59.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 123.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Fuhua Jia, Emmanuel Oluwaseyi Fagbohun, Qianyu Wang, Duoyin Zhu, Jianling Zhang, Bin Gong, Yanbin Cui. (2021) Improved thermal conductivity of styrene acrylic resin with carbon nanotubes, graphene and boron nitride hybrid fillers. Carbon Resources Conversion, [PMID:] [10.1016/j.crcon.2021.05.001] |
G2419144