Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol is a linker containing a methyltetrazine and a hydroxy moiety. This reagent enables simple and efficient incorporation of a tetrazine moiety onto antibodies, cysteine-containing peptides and other thiol-containing molecules. The hydroxyl group enables further derivatization or replacement with other reactive functional groups.
| Canonical Smiles | CC1=NN=C(N=N1)C2=CC=C(C=C2)O |
|---|---|
| IUPAC Name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol |
| InChIKey | WQYZHGNJBULAME-UHFFFAOYSA-N |
| INCHI | 1S/C9H8N4O/c1-6-10-12-9(13-11-6)7-2-4-8(14)5-3-7/h2-5,14H,1H3 |
| PubChem CID | 135712912 |
| Molecular Weight | 188.2 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Molecular Weight | 188.190 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 188.07 Da |
| Monoisotopic Mass | 188.07 Da |
| Topological Polar Surface Area | 71.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 174.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |